2AF

?

Summary

Name:2-AMINOPHENOL
Formula:C6 H7 N O
Formal charge:0
Molecular weight:109.126 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.042-aminophenol
OpenEye OEToolkits1.5.02-aminophenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04Oc1ccccc1N
SMILES_CANONICALCACTVS3.341Nc1ccccc1O
SMILESCACTVS3.341Nc1ccccc1O
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc(c(c1)N)O
SMILESOpenEye OEToolkits1.5.0c1ccc(c(c1)N)O
InChIInChI1.03InChI=1S/C6H7NO/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2
InChIKeyInChI1.03CDAWCLOXVUBKRW-UHFFFAOYSA-N
170172
PDB entries from 2020-10-21