26P

?

Summary

Name:2-AMINO-6-OXOPIMELIC ACID
Formula:C7 H11 N O5
Formal charge:0
Molecular weight:189.166 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2S)-2-amino-6-oxoheptanedioic acid
OpenEye OEToolkits1.5.0(2S)-2-amino-6-oxo-heptanedioic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(=O)CCCC(N)C(=O)O
SMILES_CANONICALCACTVS3.341N[C@@H](CCCC(=O)C(O)=O)C(O)=O
SMILESCACTVS3.341N[CH](CCCC(=O)C(O)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C(C[C@@H](C(=O)O)N)CC(=O)C(=O)O
SMILESOpenEye OEToolkits1.5.0C(CC(C(=O)O)N)CC(=O)C(=O)O
InChIInChI1.03InChI=1S/C7H11NO5/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4H,1-3,8H2,(H,10,11)(H,12,13)/t4-/m0/s1
InChIKeyInChI1.03UKCSFKLWNHUBDY-BYPYZUCNSA-N
167132
PDB entries from 2020-07-29