1PC

?

Summary

Name:1-(PHENYL-1-CYCLOHEXYL)PIPERIDINE
Synonyms:PHENCYCLIDINE
Formula:C17 H25 N
Formal charge:0
Molecular weight:243.387 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.041-(1-phenylcyclohexyl)piperidine
OpenEye OEToolkits1.5.01-(1-phenylcyclohexyl)piperidine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04c1ccccc1C3(N2CCCCC2)CCCCC3
SMILES_CANONICALCACTVS3.341C1CCN(CC1)C2(CCCCC2)c3ccccc3
SMILESCACTVS3.341C1CCN(CC1)C2(CCCCC2)c3ccccc3
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc(cc1)C2(CCCCC2)N3CCCCC3
SMILESOpenEye OEToolkits1.5.0c1ccc(cc1)C2(CCCCC2)N3CCCCC3
InChIInChI1.03InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2
InChIKeyInChI1.03JTJMJGYZQZDUJJ-UHFFFAOYSA-N
167518
PDB entries from 2020-08-12