NMK

?

Summary

Name:N-methyl Lysine
Formula:C7 H17 N2 O2
Formal charge:1
Molecular weight:161.222 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.6[(5~{S})-5-(methylamino)-6-oxidanyl-6-oxidanylidene-hexyl]azanium

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C7H16N2O2/c1-9-6(7(10)11)4-2-3-5-8/h6,9H,2-5,8H2,1H3,(H,10,11)/p+1/t6-/m0/s1
InChIKeyInChI1.03OLYPWXRMOFUVGH-LURJTMIESA-O
SMILES_CANONICALCACTVS3.385CN[C@@H](CCCC[NH3+])C(O)=O
SMILESCACTVS3.385CN[CH](CCCC[NH3+])C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6CN[C@@H](CCCC[NH3+])C(=O)O
SMILESOpenEye OEToolkits2.0.6CNC(CCCC[NH3+])C(=O)O