K4G

?

Summary

Name:3-oxo-N-[(3S)-2-oxooxolan-3-yl]tetradecanamide
Formula:C18 H31 N O4
Formal charge:0
Molecular weight:325.443 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.013-oxo-N-[(3S)-2-oxooxolan-3-yl]tetradecanamide
OpenEye OEToolkits2.0.63-oxidanylidene-~{N}-[(3~{S})-2-oxidanylideneoxolan-3-yl]tetradecanamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C(CCCCCCCCC)CC(CC(NC1C(OCC1)=O)=O)=O
InChIInChI1.03InChI=1S/C18H31NO4/c1-2-3-4-5-6-7-8-9-10-11-15(20)14-17(21)19-16-12-13-23-18(16)22/h16H,2-14H2,1H3,(H,19,21)/t16-/m0/s1
InChIKeyInChI1.03YQFJJDSGBAAUPW-INIZCTEOSA-N
SMILES_CANONICALCACTVS3.385CCCCCCCCCCCC(=O)CC(=O)N[C@H]1CCOC1=O
SMILESCACTVS3.385CCCCCCCCCCCC(=O)CC(=O)N[CH]1CCOC1=O
SMILES_CANONICALOpenEye OEToolkits2.0.6CCCCCCCCCCCC(=O)CC(=O)N[C@H]1CCOC1=O
SMILESOpenEye OEToolkits2.0.6CCCCCCCCCCCC(=O)CC(=O)NC1CCOC1=O