F0M

?

Summary

Name:2-methoxy-4-nitrophenol
Synonyms:4-Nitroguaiacol
Formula:C7 H7 N O4
Formal charge:0
Molecular weight:169.135 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.012-methoxy-4-nitrophenol
OpenEye OEToolkits2.0.62-methoxy-4-nitro-phenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01COc1c(O)ccc(c1)N(=O)=O
InChIInChI1.03InChI=1S/C7H7NO4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3
InChIKeyInChI1.03IZLVFLOBTPURLP-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385COc1cc(ccc1O)[N](=O)=O
SMILESCACTVS3.385COc1cc(ccc1O)[N](=O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6COc1cc(ccc1O)N(=O)=O
SMILESOpenEye OEToolkits2.0.6COc1cc(ccc1O)N(=O)=O