E8N

?

Summary

Name:1-ethyl-1-methyl-cyclohexane
Formula:C9 H18
Formal charge:0
Molecular weight:126.239 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.61-ethyl-1-methyl-cyclohexane

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C9H18/c1-3-9(2)7-5-4-6-8-9/h3-8H2,1-2H3
InChIKeyInChI1.03YPJRYQGOKHKNKZ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CCC1(C)CCCCC1
SMILESCACTVS3.385CCC1(C)CCCCC1
SMILES_CANONICALOpenEye OEToolkits2.0.6CCC1(CCCCC1)C
SMILESOpenEye OEToolkits2.0.6CCC1(CCCCC1)C