YCP

?

Summary

Name:(2S)-piperidine-2-carboxylic acid
Formula:C6 H11 N O2
Formal charge:0
Molecular weight:129.157 Da
Component type:L-peptide linking

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.6.1(2S)-piperidine-2-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILES_CANONICALCACTVS3.352OC(=O)[C@@H]1CCCCN1
SMILESCACTVS3.352OC(=O)[CH]1CCCCN1
SMILES_CANONICALOpenEye OEToolkits1.7.0C1CCN[C@@H](C1)C(=O)O
SMILESOpenEye OEToolkits1.7.0C1CCNC(C1)C(=O)O
InChIInChI1.03InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1
InChIKeyInChI1.03HXEACLLIILLPRG-YFKPBYRVSA-N
170172
PDB entries from 2020-10-21