XXR

?

Summary

Name:alpha-D-rhamnopyranose
Synonyms:alpha-D-rhamnose
6-deoxy-alpha-D-mannopyranose; D-rhamnose; rhamnose
Formula:C6 H12 O5
Formal charge:0
Molecular weight:164.156 Da
Component type:D-saccharide, alpha linking

Chemical Identifiers

ProgramVersionName
ACDLabs12.016-deoxy-alpha-D-mannopyranose
OpenEye OEToolkits1.7.6(2S,3S,4S,5S,6R)-6-methyloxane-2,3,4,5-tetrol
GMML1.0DRhapa
GMML1.0a-D-rhamnopyranose
PDB-CARE1.0a-D-Rhap
GMML1.0Rha

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01OC1C(O)C(OC(O)C1O)C
InChIInChI1.03InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5+,6+/m1/s1
InChIKeyInChI1.03SHZGCJCMOBCMKK-PQMKYFCFSA-N
SMILES_CANONICALCACTVS3.385C[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O
SMILESCACTVS3.385C[CH]1O[CH](O)[CH](O)[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.7.6C[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O)O)O)O
SMILESOpenEye OEToolkits1.7.6CC1C(C(C(C(O1)O)O)O)O
167327
PDB entries from 2020-08-05