VAL

?

Summary

Name:VALINE
Formula:C5 H11 N O2
Formal charge:0
Molecular weight:117.146 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.04L-valine
OpenEye OEToolkits1.5.0(2S)-2-amino-3-methyl-butanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(N)C(C)C
SMILES_CANONICALCACTVS3.341CC(C)[C@H](N)C(O)=O
SMILESCACTVS3.341CC(C)[CH](N)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CC(C)[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.5.0CC(C)C(C(=O)O)N
InChIInChI1.03InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1
InChIKeyInChI1.03KZSNJWFQEVHDMF-BYPYZUCNSA-N