URA

?

Summary

Name:URACIL
Formula:C4 H4 N2 O2
Formal charge:0
Molecular weight:112.087 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04pyrimidine-2,4(1H,3H)-dione
OpenEye OEToolkits1.5.01H-pyrimidine-2,4-dione

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C1C=CNC(=O)N1
SMILES_CANONICALCACTVS3.341O=C1NC=CC(=O)N1
SMILESCACTVS3.341O=C1NC=CC(=O)N1
SMILES_CANONICALOpenEye OEToolkits1.5.0C1=CNC(=O)NC1=O
SMILESOpenEye OEToolkits1.5.0C1=CNC(=O)NC1=O
InChIInChI1.03InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)
InChIKeyInChI1.03ISAKRJDGNUQOIC-UHFFFAOYSA-N