TSR

?

Summary

Name:2-(1H-INDOL-3-YL)ACETAMIDE
Formula:C10 H10 N2 O
Formal charge:0
Molecular weight:174.199 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.042-(1H-indol-3-yl)acetamide
OpenEye OEToolkits1.5.02-(1H-indol-3-yl)ethanamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(N)Cc2c1ccccc1nc2
SMILES_CANONICALCACTVS3.341NC(=O)Cc1c[nH]c2ccccc12
SMILESCACTVS3.341NC(=O)Cc1c[nH]c2ccccc12
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc2c(c1)c(c[nH]2)CC(=O)N
SMILESOpenEye OEToolkits1.5.0c1ccc2c(c1)c(c[nH]2)CC(=O)N
InChIInChI1.03InChI=1S/C10H10N2O/c11-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H2,11,13)
InChIKeyInChI1.03ZOAMBXDOGPRZLP-UHFFFAOYSA-N
171916
PDB entries from 2020-12-02