SST

?

Summary

Name:L-arabinitol
Synonyms:(2S,4S)-pentane-1,2,3,4,5-pentol
Formula:C5 H12 O5
Formal charge:0
Molecular weight:152.146 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01L-arabinitol
OpenEye OEToolkits1.7.6(2S,4S)-pentane-1,2,3,4,5-pentol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01OC(CO)C(O)C(O)CO
InChIInChI1.03InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m0/s1
InChIKeyInChI1.03HEBKCHPVOIAQTA-IMJSIDKUSA-N
SMILES_CANONICALCACTVS3.385OC[C@H](O)[C@@H](O)[C@@H](O)CO
SMILESCACTVS3.385OC[CH](O)[CH](O)[CH](O)CO
SMILES_CANONICALOpenEye OEToolkits1.7.6C([C@@H](C([C@H](CO)O)O)O)O
SMILESOpenEye OEToolkits1.7.6C(C(C(C(CO)O)O)O)O
167327
PDB entries from 2020-08-05