SRO

?

Summary

Name:SEROTONIN
Synonyms:3-(2-AMINOETHYL)-1H-INDOL-5-OL
Formula:C10 H12 N2 O
Formal charge:0
Molecular weight:176.215 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.043-(2-aminoethyl)-1H-indol-5-ol
OpenEye OEToolkits1.5.03-(2-aminoethyl)-1H-indol-5-ol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04Oc1cc2c(cc1)ncc2CCN
SMILES_CANONICALCACTVS3.341NCCc1c[nH]c2ccc(O)cc12
SMILESCACTVS3.341NCCc1c[nH]c2ccc(O)cc12
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc2c(cc1O)c(c[nH]2)CCN
SMILESOpenEye OEToolkits1.5.0c1cc2c(cc1O)c(c[nH]2)CCN
InChIInChI1.03InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2
InChIKeyInChI1.03QZAYGJVTTNCVMB-UHFFFAOYSA-N
171916
PDB entries from 2020-12-02