SAL

?

Summary

Name:2-HYDROXYBENZOIC ACID
Synonyms:SALICYLIC ACID
Formula:C7 H6 O3
Formal charge:0
Molecular weight:138.121 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.042-hydroxybenzoic acid
OpenEye OEToolkits1.5.02-hydroxybenzoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)c1ccccc1O
SMILES_CANONICALCACTVS3.341OC(=O)c1ccccc1O
SMILESCACTVS3.341OC(=O)c1ccccc1O
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc(c(c1)C(=O)O)O
SMILESOpenEye OEToolkits1.5.0c1ccc(c(c1)C(=O)O)O
InChIInChI1.03InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)
InChIKeyInChI1.03YGSDEFSMJLZEOE-UHFFFAOYSA-N