S2G

?

Summary

Name:(2S)-2-HYDROXYPENTANEDIOIC ACID
Formula:C5 H8 O5
Formal charge:0
Molecular weight:148.114 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2S)-2-hydroxypentanedioic acid
OpenEye OEToolkits1.7.0(2S)-2-hydroxypentanedioic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(O)CCC(=O)O
SMILES_CANONICALCACTVS3.370O[C@@H](CCC(O)=O)C(O)=O
SMILESCACTVS3.370O[CH](CCC(O)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0C(CC(=O)O)[C@@H](C(=O)O)O
SMILESOpenEye OEToolkits1.7.0C(CC(=O)O)C(C(=O)O)O
InChIInChI1.03InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/t3-/m0/s1
InChIKeyInChI1.03HWXBTNAVRSUOJR-VKHMYHEASA-N