PLM

?

Summary

Name:PALMITIC ACID
Formula:C16 H32 O2
Formal charge:0
Molecular weight:256.424 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04hexadecanoic acid
OpenEye OEToolkits1.5.0hexadecanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)CCCCCCCCCCCCCCC
SMILES_CANONICALCACTVS3.341CCCCCCCCCCCCCCCC(O)=O
SMILESCACTVS3.341CCCCCCCCCCCCCCCC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CCCCCCCCCCCCCCCC(=O)O
SMILESOpenEye OEToolkits1.5.0CCCCCCCCCCCCCCCC(=O)O
InChIInChI1.03InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)
InChIKeyInChI1.03IPCSVZSSVZVIGE-UHFFFAOYSA-N