OKM

?

Summary

Name:4-(ethylamino)-6-[(propan-2-yl)amino]-1,3,5-triazin-2-ol
Formula:C8 H15 N5 O
Formal charge:0
Molecular weight:197.238 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.014-(ethylamino)-6-[(propan-2-yl)amino]-1,3,5-triazin-2-ol
OpenEye OEToolkits2.0.74-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-ol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01CC(Nc1nc(nc(NCC)n1)O)C
InChIInChI1.03InChI=1S/C8H15N5O/c1-4-9-6-11-7(10-5(2)3)13-8(14)12-6/h5H,4H2,1-3H3,(H3,9,10,11,12,13,14)
InChIKeyInChI1.03NFMIMWNQWAWNDW-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CCNc1nc(O)nc(NC(C)C)n1
SMILESCACTVS3.385CCNc1nc(O)nc(NC(C)C)n1
SMILES_CANONICALOpenEye OEToolkits2.0.7CCNc1nc(nc(n1)O)NC(C)C
SMILESOpenEye OEToolkits2.0.7CCNc1nc(nc(n1)O)NC(C)C
170172
PDB entries from 2020-10-21