NMG

?

Summary

Name:GUANIDINO ACETATE
Synonyms:N-[AMINO(IMINO)METHYL]GLYCINE
Formula:C3 H7 N3 O2
Formal charge:0
Molecular weight:117.107 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04N-carbamimidoylglycine
OpenEye OEToolkits1.5.02-carbamimidamidoethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)CNC(=[N@H])N
SMILES_CANONICALCACTVS3.341NC(=N)NCC(O)=O
SMILESCACTVS3.341NC(=N)NCC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0[H]/N=C(/N)\NCC(=O)O
SMILESOpenEye OEToolkits1.5.0[H]N=C(N)NCC(=O)O
InChIInChI1.03InChI=1S/C3H7N3O2/c4-3(5)6-1-2(7)8/h1H2,(H,7,8)(H4,4,5,6)
InChIKeyInChI1.03BPMFZUMJYQTVII-UHFFFAOYSA-N