NFM

?

Summary

Name:N-[(4-amino-2-methylpyrimidin-5-yl)methyl]formamide
Formula:C7 H10 N4 O
Formal charge:0
Molecular weight:166.18 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs11.02N-[(4-amino-2-methylpyrimidin-5-yl)methyl]formamide
OpenEye OEToolkits1.6.1N-[(4-azanyl-2-methyl-pyrimidin-5-yl)methyl]methanamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs11.02O=CNCc1cnc(nc1N)C
SMILES_CANONICALCACTVS3.352Cc1ncc(CNC=O)c(N)n1
SMILESCACTVS3.352Cc1ncc(CNC=O)c(N)n1
SMILES_CANONICALOpenEye OEToolkits1.7.0Cc1ncc(c(n1)N)CNC=O
SMILESOpenEye OEToolkits1.7.0Cc1ncc(c(n1)N)CNC=O
InChIInChI1.03InChI=1S/C7H10N4O/c1-5-10-3-6(2-9-4-12)7(8)11-5/h3-4H,2H2,1H3,(H,9,12)(H2,8,10,11)
InChIKeyInChI1.03PVWNFAGYFUUDRC-UHFFFAOYSA-N
168889
PDB entries from 2020-09-16