NCD

?

Summary

Name:N-CARBAMOYL-L-ASPARTATE
Formula:C5 H8 N2 O5
Formal charge:0
Molecular weight:176.127 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04N-carbamoyl-L-aspartic acid
OpenEye OEToolkits1.5.0(2S)-2-(aminocarbonylamino)butanedioic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(NC(=O)N)CC(=O)O
SMILES_CANONICALCACTVS3.341NC(=O)N[C@@H](CC(O)=O)C(O)=O
SMILESCACTVS3.341NC(=O)N[CH](CC(O)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C([C@@H](C(=O)O)NC(=O)N)C(=O)O
SMILESOpenEye OEToolkits1.5.0C(C(C(=O)O)NC(=O)N)C(=O)O
InChIInChI1.03InChI=1S/C5H8N2O5/c6-5(12)7-2(4(10)11)1-3(8)9/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12)/t2-/m0/s1
InChIKeyInChI1.03HLKXYZVTANABHZ-REOHCLBHSA-N