MRY

?

Summary

Name:MESO-ERYTHRITOL
Formula:C4 H10 O4
Formal charge:0
Molecular weight:122.12 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2R,3S)-butane-1,2,3,4-tetrol
OpenEye OEToolkits1.5.0(2R,3S)-butane-1,2,3,4-tetrol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OCC(O)C(O)CO
SMILES_CANONICALCACTVS3.341OC[C@@H](O)[C@@H](O)CO
SMILESCACTVS3.341OC[CH](O)[CH](O)CO
SMILES_CANONICALOpenEye OEToolkits1.5.0C([C@H]([C@H](CO)O)O)O
SMILESOpenEye OEToolkits1.5.0C(C(C(CO)O)O)O
InChIInChI1.03InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4+
InChIKeyInChI1.03UNXHWFMMPAWVPI-ZXZARUISSA-N
169117
PDB entries from 2020-09-23