LTH

?

Summary

Name:(2R,3S)-2,3,4-trihydroxybutanoic acid
Synonyms:L-Threonic acid
Formula:C4 H8 O5
Formal charge:0
Molecular weight:136.103 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2R,3S)-2,3,4-trihydroxybutanoic acid
OpenEye OEToolkits1.9.2(2R,3S)-2,3,4-tris(oxidanyl)butanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(O)C(O)CO
InChIInChI1.03InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3+/m0/s1
InChIKeyInChI1.03JPIJQSOTBSSVTP-STHAYSLISA-N
SMILES_CANONICALCACTVS3.385OC[C@H](O)[C@@H](O)C(O)=O
SMILESCACTVS3.385OC[CH](O)[CH](O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.9.2C([C@@H]([C@H](C(=O)O)O)O)O
SMILESOpenEye OEToolkits1.9.2C(C(C(C(=O)O)O)O)O
170172
PDB entries from 2020-10-21