LFC

?

Summary

Name:6-DEOXY-L-GALACTONIC ACID
Formula:C6 H12 O6
Formal charge:0
Molecular weight:180.156 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.046-deoxy-L-galactonic acid
OpenEye OEToolkits1.5.0(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(O)C(O)C(O)C(O)C
SMILES_CANONICALCACTVS3.341C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O
SMILESCACTVS3.341C[CH](O)[CH](O)[CH](O)[CH](O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C[C@@H]([C@H]([C@H]([C@@H](C(=O)O)O)O)O)O
SMILESOpenEye OEToolkits1.5.0CC(C(C(C(C(=O)O)O)O)O)O
InChIInChI1.03InChI=1S/C6H12O6/c1-2(7)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H3,(H,11,12)/t2-,3+,4+,5-/m0/s1
InChIKeyInChI1.03NBFWIISVIFCMDK-RSJOWCBRSA-N