KMH

?

Summary

Name:(5S)-5-AMINO-3-OXO-HEXANOIC ACID
Formula:C6 H11 N O3
Formal charge:0
Molecular weight:145.156 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.6.1(5S)-5-amino-3-oxo-hexanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILES_CANONICALCACTVS3.352C[C@H](N)CC(=O)CC(O)=O
SMILESCACTVS3.352C[CH](N)CC(=O)CC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.6.1C[C@@H](CC(=O)CC(=O)O)N
SMILESOpenEye OEToolkits1.6.1CC(CC(=O)CC(=O)O)N
InChIInChI1.03InChI=1S/C6H11NO3/c1-4(7)2-5(8)3-6(9)10/h4H,2-3,7H2,1H3,(H,9,10)/t4-/m0/s1
InChIKeyInChI1.03FAASBXNEOGMQHS-BYPYZUCNSA-N
170172
PDB entries from 2020-10-21