K1S

?

Summary

Name:N,N-diethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Formula:C10 H15 N5
Formal charge:0
Molecular weight:205.26 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01N,N-diethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
OpenEye OEToolkits2.0.6~{N},~{N}-diethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01n1c(cc(n2ncnc12)N(CC)CC)C
InChIInChI1.03InChI=1S/C10H15N5/c1-4-14(5-2)9-6-8(3)13-10-11-7-12-15(9)10/h6-7H,4-5H2,1-3H3
InChIKeyInChI1.03GSNOZLZNQMLSKJ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CCN(CC)c1cc(C)nc2ncnn12
SMILESCACTVS3.385CCN(CC)c1cc(C)nc2ncnn12
SMILES_CANONICALOpenEye OEToolkits2.0.6CCN(CC)c1cc(nc2n1ncn2)C
SMILESOpenEye OEToolkits2.0.6CCN(CC)c1cc(nc2n1ncn2)C