J0M

?

Summary

Name:D-galactonic acid
Synonyms:D-galactonate
Formula:C6 H12 O7
Formal charge:0
Molecular weight:196.155 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01D-galactonic acid
OpenEye OEToolkits2.0.6(2~{R},3~{S},4~{S},5~{R})-2,3,4,5,6-pentakis(oxidanyl)hexanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C(C(C(C(CO)O)O)O)(O)C(O)=O
InChIInChI1.03InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4+,5-/m1/s1
InChIKeyInChI1.03RGHNJXZEOKUKBD-MGCNEYSASA-N
SMILES_CANONICALCACTVS3.385OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(O)=O
SMILESCACTVS3.385OC[CH](O)[CH](O)[CH](O)[CH](O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6C([C@H]([C@@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O
SMILESOpenEye OEToolkits2.0.6C(C(C(C(C(C(=O)O)O)O)O)O)O