HMH

?

Summary

Name:4-AMINO-5-HYDROXYMETHYL-2-METHYLPYRIMIDINE
Formula:C6 H9 N3 O
Formal charge:0
Molecular weight:139.155 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(4-amino-2-methylpyrimidin-5-yl)methanol
OpenEye OEToolkits1.5.0(4-amino-2-methyl-pyrimidin-5-yl)methanol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04n1c(N)c(cnc1C)CO
SMILES_CANONICALCACTVS3.341Cc1ncc(CO)c(N)n1
SMILESCACTVS3.341Cc1ncc(CO)c(N)n1
SMILES_CANONICALOpenEye OEToolkits1.5.0Cc1ncc(c(n1)N)CO
SMILESOpenEye OEToolkits1.5.0Cc1ncc(c(n1)N)CO
InChIInChI1.03InChI=1S/C6H9N3O/c1-4-8-2-5(3-10)6(7)9-4/h2,10H,3H2,1H3,(H2,7,8,9)
InChIKeyInChI1.03VUTBELPREDJDDH-UHFFFAOYSA-N
167518
PDB entries from 2020-08-12