GTQ

?

Summary

Name:2,5-dihydroxybenzoic acid
Formula:C7 H6 O4
Formal charge:0
Molecular weight:154.12 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs11.022,5-dihydroxybenzoic acid
OpenEye OEToolkits1.6.12,5-dihydroxybenzoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs11.02O=C(O)c1cc(O)ccc1O
SMILES_CANONICALCACTVS3.352OC(=O)c1cc(O)ccc1O
SMILESCACTVS3.352OC(=O)c1cc(O)ccc1O
SMILES_CANONICALOpenEye OEToolkits1.7.0c1cc(c(cc1O)C(=O)O)O
SMILESOpenEye OEToolkits1.7.0c1cc(c(cc1O)C(=O)O)O
InChIInChI1.03InChI=1S/C7H6O4/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,8-9H,(H,10,11)
InChIKeyInChI1.03WXTMDXOMEHJXQO-UHFFFAOYSA-N