GOA

?

Summary

Name:GLYCOLIC ACID
Synonyms:HYDROXYACETIC ACID
HYDROXYETHANOIC ACID
Formula:C2 H4 O3
Formal charge:0
Molecular weight:76.051 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01hydroxyacetic acid
OpenEye OEToolkits1.7.02-hydroxyethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)CO
SMILES_CANONICALCACTVS3.370OCC(O)=O
SMILESCACTVS3.370OCC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0C(C(=O)O)O
SMILESOpenEye OEToolkits1.7.0C(C(=O)O)O
InChIInChI1.03InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)
InChIKeyInChI1.03AEMRFAOFKBGASW-UHFFFAOYSA-N