EPO

?

Summary

Name:(2R,3R)-oxirane-2,3-dicarboxylic acid
Formula:C4 H4 O5
Formal charge:0
Molecular weight:132.072 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2R,3R)-oxirane-2,3-dicarboxylic acid
OpenEye OEToolkits1.7.0(3R)-oxirane-2,3-dicarboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C1OC1C(=O)O
SMILES_CANONICALCACTVS3.370OC(=O)[C@@H]1O[C@H]1C(O)=O
SMILESCACTVS3.370OC(=O)[CH]1O[CH]1C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.0[C@@H]1(C(O1)C(=O)O)C(=O)O
SMILESOpenEye OEToolkits1.7.0C1(C(O1)C(=O)O)C(=O)O
InChIInChI1.03InChI=1S/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/t1-,2-/m1/s1
InChIKeyInChI1.03DCEMCPAKSGRHCN-JCYAYHJZSA-N
171313
PDB entries from 2020-11-18