EPA

?

Summary

Name:5,8,11,14,17-EICOSAPENTAENOIC ACID
Formula:C20 H30 O2
Formal charge:0
Molecular weight:302.451 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoic acid
OpenEye OEToolkits1.5.0(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)CCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC
SMILES_CANONICALCACTVS3.341CC\C=C/C/C=C\C\C=C/C/C=C\C\C=C/CCCC(O)=O
SMILESCACTVS3.341CCC=CCC=CCC=CCC=CCC=CCCCC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)O
SMILESOpenEye OEToolkits1.5.0CCC=CCC=CCC=CCC=CCC=CCCCC(=O)O
InChIInChI1.03InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-15-
InChIKeyInChI1.03JAZBEHYOTPTENJ-JLNKQSITSA-N