EIC

?

Summary

Name:LINOLEIC ACID
Synonyms:9,12-LINOLEIC ACID
Formula:C18 H32 O2
Formal charge:0
Molecular weight:280.445 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(9Z,12Z)-octadeca-9,12-dienoic acid
OpenEye OEToolkits1.5.0(9Z,12Z)-octadeca-9,12-dienoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)CCCCCCC\C=C/C\C=C/CCCCC
SMILES_CANONICALCACTVS3.341CCCCC/C=C\C\C=C/CCCCCCCC(O)=O
SMILESCACTVS3.341CCCCCC=CCC=CCCCCCCCC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CCCCC\C=C/C\C=C/CCCCCCCC(=O)O
SMILESOpenEye OEToolkits1.5.0CCCCCC=CCC=CCCCCCCCC(=O)O
InChIInChI1.03InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9-
InChIKeyInChI1.03OYHQOLUKZRVURQ-HZJYTTRNSA-N