DNP

?

Summary

Name:3-AMINO-ALANINE
Formula:C3 H9 N2 O2
Formal charge:1
Molecular weight:105.116 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.043-ammonio-L-alanine
OpenEye OEToolkits1.5.0[(2S)-2-amino-3-hydroxy-3-oxo-propyl]azanium

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(N)C[NH3+]
SMILES_CANONICALCACTVS3.341N[C@@H](C[NH3+])C(O)=O
SMILESCACTVS3.341N[CH](C[NH3+])C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C([C@@H](C(=O)O)N)[NH3+]
SMILESOpenEye OEToolkits1.5.0C(C(C(=O)O)N)[NH3+]
InChIInChI1.03InChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/p+1/t2-/m0/s1
InChIKeyInChI1.03PECYZEOJVXMISF-REOHCLBHSA-O
170172
PDB entries from 2020-10-21