DIF

?

Summary

Name:2-[2,6-DICHLOROPHENYL)AMINO]BENZENEACETIC ACID
Synonyms:DICLOFENAC
Formula:C14 H11 Cl2 N O2
Formal charge:0
Molecular weight:296.149 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04{2-[(2,6-dichlorophenyl)amino]phenyl}acetic acid
OpenEye OEToolkits1.5.02-[2-[(2,6-dichlorophenyl)amino]phenyl]ethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04Clc2cccc(Cl)c2Nc1ccccc1CC(=O)O
SMILES_CANONICALCACTVS3.341OC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl
SMILESCACTVS3.341OC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc(c(c1)CC(=O)O)Nc2c(cccc2Cl)Cl
SMILESOpenEye OEToolkits1.5.0c1ccc(c(c1)CC(=O)O)Nc2c(cccc2Cl)Cl
InChIInChI1.03InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)
InChIKeyInChI1.03DCOPUUMXTXDBNB-UHFFFAOYSA-N