CYY

?

Summary

Name:2-DEOXYSTREPTAMINE
Formula:C6 H14 N2 O3
Formal charge:0
Molecular weight:162.187 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(1R,2r,3S,4R,6S)-4,6-diaminocyclohexane-1,2,3-triol
OpenEye OEToolkits1.5.0(1S,3R,4S,6R)-4,6-diaminocyclohexane-1,2,3-triol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OC1C(N)CC(N)C(O)C1O
SMILES_CANONICALCACTVS3.341N[C@@H]1C[C@H](N)[C@@H](O)[C@H](O)[C@H]1O
SMILESCACTVS3.341N[CH]1C[CH](N)[CH](O)[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.5.0C1[C@H]([C@@H](C([C@@H]([C@H]1N)O)O)O)N
SMILESOpenEye OEToolkits1.5.0C1C(C(C(C(C1N)O)O)O)N
InChIInChI1.03InChI=1S/C6H14N2O3/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,9-11H,1,7-8H2/t2-,3+,4+,5-,6-
InChIKeyInChI1.03DTFAJAKTSMLKAT-JDCCYXBGSA-N