CYT

?

Summary

Name:6-AMINOPYRIMIDIN-2(1H)-ONE
Synonyms:CYTOSINE
Formula:C4 H5 N3 O
Formal charge:0
Molecular weight:111.102 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.046-aminopyrimidin-2(1H)-one
OpenEye OEToolkits1.5.04-amino-3H-pyrimidin-2-one

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C1N=CC=C(N)N1
SMILES_CANONICALCACTVS3.341NC1=CC=NC(=O)N1
SMILESCACTVS3.341NC1=CC=NC(=O)N1
SMILES_CANONICALOpenEye OEToolkits1.5.0C1=C(NC(=O)N=C1)N
SMILESOpenEye OEToolkits1.5.0C1=C(NC(=O)N=C1)N
InChIInChI1.03InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8)
InChIKeyInChI1.03OPTASPLRGRRNAP-UHFFFAOYSA-N
170172
PDB entries from 2020-10-21