CVU

?

Summary

Name:L-Fuculose open form
Synonyms:6-deoxy-L-tagatose
Formula:C6 H12 O5
Formal charge:0
Molecular weight:164.156 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.016-deoxy-L-tagatose
OpenEye OEToolkits1.7.6(3R,4R,5S)-1,3,4,5-tetrakis(oxidanyl)hexan-2-one

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(C(O)C(O)C(O)C)CO
InChIInChI1.03InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h3,5-8,10-11H,2H2,1H3/t3-,5+,6-/m0/s1
InChIKeyInChI1.03QZNPNKJXABGCRC-LFRDXLMFSA-N
SMILES_CANONICALCACTVS3.385C[C@H](O)[C@@H](O)[C@@H](O)C(=O)CO
SMILESCACTVS3.385C[CH](O)[CH](O)[CH](O)C(=O)CO
SMILES_CANONICALOpenEye OEToolkits1.7.6C[C@@H]([C@H]([C@H](C(=O)CO)O)O)O
SMILESOpenEye OEToolkits1.7.6CC(C(C(C(=O)CO)O)O)O