BNL

?

Summary

Name:BIPHENYL
Formula:C12 H10
Formal charge:0
Molecular weight:154.208 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs11.02biphenyl
OpenEye OEToolkits1.6.11,1'-biphenyl

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs11.02c1cc(ccc1)c2ccccc2
SMILES_CANONICALCACTVS3.352c1ccc(cc1)c2ccccc2
SMILESCACTVS3.352c1ccc(cc1)c2ccccc2
SMILES_CANONICALOpenEye OEToolkits1.7.0c1ccc(cc1)c2ccccc2
SMILESOpenEye OEToolkits1.7.0c1ccc(cc1)c2ccccc2
InChIInChI1.03InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H
InChIKeyInChI1.03ZUOUZKKEUPVFJK-UHFFFAOYSA-N
170172
PDB entries from 2020-10-21