AZZ

?

Summary

Name:3'-azido-3'-deoxythymidine
Synonyms:Azidothymidine
Zidovudine
Formula:C10 H13 N5 O4
Formal charge:0
Molecular weight:267.241 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.013'-azido-3'-deoxythymidine
OpenEye OEToolkits1.7.61-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-pyrimidine-2,4-dione

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C1NC(=O)N(C=C1C)C2OC(C(\N=[N+]=[N-])C2)CO
InChIInChI1.03InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1
InChIKeyInChI1.03HBOMLICNUCNMMY-XLPZGREQSA-N
SMILES_CANONICALCACTVS3.370CC1=CN([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)C(=O)NC1=O
SMILESCACTVS3.370CC1=CN([CH]2C[CH](N=[N+]=[N-])[CH](CO)O2)C(=O)NC1=O
SMILES_CANONICALOpenEye OEToolkits1.7.6CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)N=[N+]=[N-]
SMILESOpenEye OEToolkits1.7.6CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)N=[N+]=[N-]