AN4

?

Summary

Name:3,4,5,6-tetrahydro-2,3'-bipyridine
Synonyms:anabaseine
Formula:C10 H12 N2
Formal charge:0
Molecular weight:160.216 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
ACDLabs10.043,4,5,6-tetrahydro-2,3'-bipyridine
OpenEye OEToolkits1.6.13-(3,4,5,6-tetrahydropyridin-2-yl)pyridine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04n2cc(C1=NCCCC1)ccc2
SMILES_CANONICALCACTVS3.352C1CCC(=NC1)c2cccnc2
SMILESCACTVS3.352C1CCC(=NC1)c2cccnc2
SMILES_CANONICALOpenEye OEToolkits1.6.1c1cc(cnc1)C2=NCCCC2
SMILESOpenEye OEToolkits1.6.1c1cc(cnc1)C2=NCCCC2
InChIInChI1.03InChI=1S/C10H12N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8H,1-2,5,7H2
InChIKeyInChI1.03AUBPMADJYNSPOA-UHFFFAOYSA-N