AN3

?

Summary

Name:ANTHRACENE
Formula:C14 H10
Formal charge:0
Molecular weight:178.229 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04anthracene
OpenEye OEToolkits1.5.0anthracene

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04c3ccc2cc1ccccc1cc2c3
SMILES_CANONICALCACTVS3.341c1ccc2cc3ccccc3cc2c1
SMILESCACTVS3.341c1ccc2cc3ccccc3cc2c1
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc2cc3ccccc3cc2c1
SMILESOpenEye OEToolkits1.5.0c1ccc2cc3ccccc3cc2c1
InChIInChI1.03InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H
InChIKeyInChI1.03MWPLVEDNUUSJAV-UHFFFAOYSA-N
167327
PDB entries from 2020-08-05