AHN

?

Summary

Name:N-[2-(1H-IMIDAZOL-4-YL)ETHYL]ACETAMIDE
Synonyms:N-ACETYLHISTAMINE
Formula:C7 H11 N3 O
Formal charge:0
Molecular weight:153.182 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04N-[2-(1H-imidazol-4-yl)ethyl]acetamide
OpenEye OEToolkits1.5.0N-[2-(1H-imidazol-4-yl)ethyl]ethanamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(NCCc1ncnc1)C
SMILES_CANONICALCACTVS3.341CC(=O)NCCc1c[nH]cn1
SMILESCACTVS3.341CC(=O)NCCc1c[nH]cn1
SMILES_CANONICALOpenEye OEToolkits1.5.0CC(=O)NCCc1c[nH]cn1
SMILESOpenEye OEToolkits1.5.0CC(=O)NCCc1c[nH]cn1
InChIInChI1.03InChI=1S/C7H11N3O/c1-6(11)9-3-2-7-4-8-5-10-7/h4-5H,2-3H2,1H3,(H,8,10)(H,9,11)
InChIKeyInChI1.03XJWPISBUKWZALE-UHFFFAOYSA-N