ACT

?

Summary

Name:ACETATE ION
Formula:C2 H3 O2
Formal charge:-1
Molecular weight:59.044 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04acetate
OpenEye OEToolkits1.5.0ethanoate

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04[O-]C(=O)C
SMILES_CANONICALCACTVS3.341CC([O-])=O
SMILESCACTVS3.341CC([O-])=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CC(=O)[O-]
SMILESOpenEye OEToolkits1.5.0CC(=O)[O-]
InChIInChI1.03InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1
InChIKeyInChI1.03QTBSBXVTEAMEQO-UHFFFAOYSA-M