9FL

?

Summary

Name:9H-fluorene
Formula:C13 H10
Formal charge:0
Molecular weight:166.218 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.019H-fluorene
OpenEye OEToolkits1.7.69H-fluorene

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01c1cccc3c1c2c(cccc2)C3
InChIInChI1.03InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2
InChIKeyInChI1.03NIHNNTQXNPWCJQ-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385C1c2ccccc2c3ccccc13
SMILESCACTVS3.385C1c2ccccc2c3ccccc13
SMILES_CANONICALOpenEye OEToolkits1.7.6c1ccc-2c(c1)Cc3c2cccc3
SMILESOpenEye OEToolkits1.7.6c1ccc-2c(c1)Cc3c2cccc3