8GC

?

Summary

Name:3-carbamoyl-1-methylpyridin-1-ium
Synonyms:1-methylnicotinamide
Formula:C7 H9 N2 O
Formal charge:1
Molecular weight:137.159 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.013-carbamoyl-1-methylpyridin-1-ium
OpenEye OEToolkits2.0.61-methylpyridin-1-ium-3-carboxamide

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C(N)(=O)c1ccc[n+](C)c1
InChIInChI1.03InChI=1S/C7H8N2O/c1-9-4-2-3-6(5-9)7(8)10/h2-5H,1H3,(H-,8,10)/p+1
InChIKeyInChI1.03LDHMAVIPBRSVRG-UHFFFAOYSA-O
SMILES_CANONICALCACTVS3.385C[n+]1cccc(c1)C(N)=O
SMILESCACTVS3.385C[n+]1cccc(c1)C(N)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6C[n+]1cccc(c1)C(=O)N
SMILESOpenEye OEToolkits2.0.6C[n+]1cccc(c1)C(=O)N