4CH

?

Summary

Name:4-chlorophenol
Formula:C6 H5 Cl O
Formal charge:0
Molecular weight:128.556 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.044-chlorophenol
OpenEye OEToolkits1.5.04-chlorophenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04Clc1ccc(O)cc1
SMILES_CANONICALCACTVS3.341Oc1ccc(Cl)cc1
SMILESCACTVS3.341Oc1ccc(Cl)cc1
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc(ccc1O)Cl
SMILESOpenEye OEToolkits1.5.0c1cc(ccc1O)Cl
InChIInChI1.03InChI=1S/C6H5ClO/c7-5-1-3-6(8)4-2-5/h1-4,8H
InChIKeyInChI1.03WXNZTHHGJRFXKQ-UHFFFAOYSA-N