2PP

?

Summary

Name:2-PROPYL-PENTANOIC ACID
Formula:C8 H16 O2
Formal charge:0
Molecular weight:144.211 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.042-propylpentanoic acid
OpenEye OEToolkits1.5.02-propylpentanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(CCC)CCC
SMILES_CANONICALCACTVS3.341CCCC(CCC)C(O)=O
SMILESCACTVS3.341CCCC(CCC)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CCCC(CCC)C(=O)O
SMILESOpenEye OEToolkits1.5.0CCCC(CCC)C(=O)O
InChIInChI1.03InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)
InChIKeyInChI1.03NIJJYAXOARWZEE-UHFFFAOYSA-N