2HC

?

Summary

Name:(2E)-3-(2-HYDROXYPHENYL)ACRYLIC ACID
Synonyms:TRANS-2-HYDROXYCINNAMIC ACID
O-COUMARIC ACID
Formula:C9 H8 O3
Formal charge:0
Molecular weight:164.158 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2E)-3-(2-hydroxyphenyl)prop-2-enoic acid
OpenEye OEToolkits1.5.0(E)-3-(2-hydroxyphenyl)prop-2-enoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)/C=C/c1ccccc1O
SMILES_CANONICALCACTVS3.341OC(=O)\C=C\c1ccccc1O
SMILESCACTVS3.341OC(=O)C=Cc1ccccc1O
SMILES_CANONICALOpenEye OEToolkits1.5.0c1ccc(c(c1)\C=C\C(=O)O)O
SMILESOpenEye OEToolkits1.5.0c1ccc(c(c1)C=CC(=O)O)O
InChIInChI1.03InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+
InChIKeyInChI1.03PMOWTIHVNWZYFI-AATRIKPKSA-N