2DR

?

Summary

Name:2-deoxy-beta-D-erythro-pentofuranose
Synonyms:2-deoxy-beta-D-ribofuranose
2-deoxy-beta-D-erythro-pentose; 2-deoxy-D-erythro-pentose; 2-deoxy-erythro-pentose
Formula:C5 H10 O4
Formal charge:0
Molecular weight:134.13 Da
Component type:D-saccharide, beta linking

Chemical Identifiers

ProgramVersionName
ACDLabs10.042-deoxy-beta-D-erythro-pentofuranose
OpenEye OEToolkits1.6.1(2R,4S,5R)-5-(hydroxymethyl)oxolane-2,4-diol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OCC1OC(O)CC1O
SMILES_CANONICALCACTVS3.352OC[C@H]1O[C@@H](O)C[C@@H]1O
SMILESCACTVS3.352OC[CH]1O[CH](O)C[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.6.1C1[C@@H]([C@H](O[C@H]1O)CO)O
SMILESOpenEye OEToolkits1.6.1C1C(C(OC1O)CO)O
InChIInChI1.03InChI=1S/C5H10O4/c6-2-4-3(7)1-5(8)9-4/h3-8H,1-2H2/t3-,4+,5+/m0/s1
InChIKeyInChI1.03PDWIQYODPROSQH-VPENINKCSA-N
170172
PDB entries from 2020-10-21